C23H33ClN4O3 — CID 126479522
4-[3-(dipropylamino)propylamino]-N-(3-methylphenyl)-3-nitrobenzamide;hydrochloride (PubChem CID 126479522) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is 4-[3-(dipropylamino)propylamino]-N-(3-methylphenyl)-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-[3-(dipropylamino)propylamino]-N-(3-methylphenyl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 126479522 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 4-[3-(dipropylamino)propylamino]-N-(3-methylphenyl)-3-nitrobenzamide;hydrochloride |
| SMILES | CCCN(CCC)CCCNc1ccc(C(=O)Nc2cccc(C)c2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C23H32N4O3.ClH/c1-4-13-26(14-5-2)15-7-12-24-21-11-10-19(17-22(21)27(29)30)23(28)25-20-9-6-8-18(3)16-20;/h6,8-11,16-17,24H,4-5,7,12-15H2,1-3H3,(H,25,28);1H |
| InChIKey | IYKAUCJKNWZDFH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|