C26H27F3N4O3 — CID 46371453
4-[3-(N-ethyl-3-methylanilino)propylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 46371453) has the molecular formula C26H27F3N4O3 and a molecular weight of 500.52 g/mol. Its IUPAC name is 4-[3-(N-ethyl-3-methylanilino)propylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[3-(N-ethyl-3-methylanilino)propylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46371453 |
| Molecular Formula | C26H27F3N4O3 |
| Molecular Weight | 500.52 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 4-[3-(N-ethyl-3-methylanilino)propylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCN(CCCNc1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)cc1[N+](=O)[O-])c1cccc(C)c1 |
| InChI | InChI=1S/C26H27F3N4O3/c1-3-32(22-7-4-6-18(2)16-22)15-5-14-30-23-13-8-19(17-24(23)33(35)36)25(34)31-21-11-9-20(10-12-21)26(27,28)29/h4,6-13,16-17,30H,3,5,14-15H2,1-2H3,(H,31,34) |
| InChIKey | LEMQYCBVZGNSFL-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|