C21H14Cl2F3N3O3 — CID 46371251
4-[(3,4-dichlorophenyl)methylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 46371251) has the molecular formula C21H14Cl2F3N3O3 and a molecular weight of 484.26 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)methylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(3,4-dichlorophenyl)methylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 46371251 |
| Molecular Formula | C21H14Cl2F3N3O3 |
| Molecular Weight | 484.26 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)methylamino]-3-nitro-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccc(Cl)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H14Cl2F3N3O3/c22-16-7-1-12(9-17(16)23)11-27-18-8-2-13(10-19(18)29(31)32)20(30)28-15-5-3-14(4-6-15)21(24,25)26/h1-10,27H,11H2,(H,28,30) |
| InChIKey | CLZBXPQFJUOAAD-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.26 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|