C22H37N3O2 — CID 7323883
(3R)-N-[3-(diethylamino)propyl]-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 7323883) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is (3R)-N-[3-(diethylamino)propyl]-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide.
| Compound Name | (3R)-N-[3-(diethylamino)propyl]-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 7323883 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | (3R)-N-[3-(diethylamino)propyl]-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CCN(CC)CCCNC(=O)C[C@@H](C)CC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H37N3O2/c1-6-25(7-2)14-8-13-23-21(26)15-18(5)16-22(27)24-20-11-9-19(10-12-20)17(3)4/h9-12,17-18H,6-8,13-16H2,1-5H3,(H,23,26)(H,24,27)/t18-/m1/s1 |
| InChIKey | LXLCAFFEZAMMSY-GOSISDBHSA-N |
| XLogP | 4.01 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|