C23H38N2O2 — CID 4567279
N-(2-ethylhexyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 4567279) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N-(2-ethylhexyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide.
| Compound Name | N-(2-ethylhexyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 4567279 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | N-(2-ethylhexyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CCCCC(CC)CNC(=O)CC(C)CC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C23H38N2O2/c1-6-8-9-19(7-2)16-24-22(26)14-18(5)15-23(27)25-21-12-10-20(11-13-21)17(3)4/h10-13,17-19H,6-9,14-16H2,1-5H3,(H,24,26)(H,25,27) |
| InChIKey | UOKJYKAECCVMTM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |