C22H36N2O3 — CID 51362485
N-(3-butoxypropyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide (PubChem CID 51362485) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is N-(3-butoxypropyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide.
| Compound Name | N-(3-butoxypropyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
|---|---|
| PubChem CID | 51362485 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-(3-butoxypropyl)-3-methyl-N'-(4-propan-2-ylphenyl)pentanediamide |
| SMILES | CCCCOCCCNC(=O)CC(C)CC(=O)Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H36N2O3/c1-5-6-13-27-14-7-12-23-21(25)15-18(4)16-22(26)24-20-10-8-19(9-11-20)17(2)3/h8-11,17-18H,5-7,12-16H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | QMRXHPPAOYYKGZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|