C27H32N6O2S — CID 126479214
1-[1-[4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzoyl]piperidin-4-yl]piperidine-4-carboxamide (PubChem CID 126479214) has the molecular formula C27H32N6O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is 1-[1-[4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzoyl]piperidin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzoyl]piperidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 126479214 |
| Molecular Formula | C27H32N6O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | 1-[1-[4-[[(2-sulfanylidene-1H-quinazolin-4-yl)amino]methyl]benzoyl]piperidin-4-yl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C2CCN(C(=O)c3ccc(CNc4nc(=S)[nH]c5ccccc45)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H32N6O2S/c28-24(34)19-9-13-32(14-10-19)21-11-15-33(16-12-21)26(35)20-7-5-18(6-8-20)17-29-25-22-3-1-2-4-23(22)30-27(36)31-25/h1-8,19,21H,9-17H2,(H2,28,34)(H2,29,30,31,36) |
| InChIKey | SXLSMPFCWNETRH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|