C24H19N3O6S — CID 126479306
6-[[2-[(2-methylbenzoyl)amino]phenyl]sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 126479306) has the molecular formula C24H19N3O6S and a molecular weight of 477.50 g/mol. Its IUPAC name is 6-[[2-[(2-methylbenzoyl)amino]phenyl]sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-[[2-[(2-methylbenzoyl)amino]phenyl]sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 126479306 |
| Molecular Formula | C24H19N3O6S |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 6-[[2-[(2-methylbenzoyl)amino]phenyl]sulfamoyl]-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | Cc1ccccc1C(=O)Nc1ccccc1NS(=O)(=O)c1ccc2[nH]cc(C(=O)O)c(=O)c2c1 |
| InChI | InChI=1S/C24H19N3O6S/c1-14-6-2-3-7-16(14)23(29)26-20-8-4-5-9-21(20)27-34(32,33)15-10-11-19-17(12-15)22(28)18(13-25-19)24(30)31/h2-13,27H,1H3,(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | JIFXNJNJKLISER-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |