C11H13ClN4O3 — CID 126479547
6-chloro-N-(2-methoxyethyl)-5-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 126479547) has the molecular formula C11H13ClN4O3 and a molecular weight of 284.70 g/mol. Its IUPAC name is 6-chloro-N-(2-methoxyethyl)-5-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 6-chloro-N-(2-methoxyethyl)-5-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126479547 |
| Molecular Formula | C11H13ClN4O3 |
| Molecular Weight | 284.70 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 6-chloro-N-(2-methoxyethyl)-5-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COCCNC(=O)c1c[nH]n2c(=O)c(Cl)c(C)nc12 |
| InChI | InChI=1S/C11H13ClN4O3/c1-6-8(12)11(18)16-9(15-6)7(5-14-16)10(17)13-3-4-19-2/h5,14H,3-4H2,1-2H3,(H,13,17) |
| InChIKey | LUOWYXPJDNCFRF-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.70 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|