C10H15N3O3 — CID 136911216
N-(2-methoxyethyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 136911216) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136911216 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-(2-methoxyethyl)-2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | COCCNC(=O)c1c(C)nc(C)[nH]c1=O |
| InChI | InChI=1S/C10H15N3O3/c1-6-8(9(14)11-4-5-16-3)10(15)13-7(2)12-6/h4-5H2,1-3H3,(H,11,14)(H,12,13,15) |
| InChIKey | LFHZRASIOHBOHI-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|