C13H15ClN2O4 — CID 126484816
2-(aminomethyl)-N-(2-hydroxyethyl)-4-oxochromene-6-carboxamide;hydrochloride (PubChem CID 126484816) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-hydroxyethyl)-4-oxochromene-6-carboxamide;hydrochloride.
| Compound Name | 2-(aminomethyl)-N-(2-hydroxyethyl)-4-oxochromene-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 126484816 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(aminomethyl)-N-(2-hydroxyethyl)-4-oxochromene-6-carboxamide;hydrochloride |
| SMILES | Cl.NCc1cc(=O)c2cc(C(=O)NCCO)ccc2o1 |
| InChI | InChI=1S/C13H14N2O4.ClH/c14-7-9-6-11(17)10-5-8(1-2-12(10)19-9)13(18)15-3-4-16;/h1-2,5-6,16H,3-4,7,14H2,(H,15,18);1H |
| InChIKey | ANJIHCZFWOCDTF-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |