C26H33N3O3 — CID 126490262
2-[3,5-dimethyl-1-[[4-[[(1S,3S,5S,7R)-5-methyltricyclo[5.2.1.03,9]decane-2-carbonyl]amino]phenyl]methyl]pyrazol-4-yl]acetic acid (PubChem CID 126490262) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-[[4-[[(1S,3S,5S,7R)-5-methyltricyclo[5.2.1.03,9]decane-2-carbonyl]amino]phenyl]methyl]pyrazol-4-yl]acetic acid.
| Compound Name | 2-[3,5-dimethyl-1-[[4-[[(1S,3S,5S,7R)-5-methyltricyclo[5.2.1.03,9]decane-2-carbonyl]amino]phenyl]methyl]pyrazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 126490262 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[3,5-dimethyl-1-[[4-[[(1S,3S,5S,7R)-5-methyltricyclo[5.2.1.03,9]decane-2-carbonyl]amino]phenyl]methyl]pyrazol-4-yl]acetic acid |
| SMILES | Cc1nn(Cc2ccc(NC(=O)C3[C@H]4C[C@@H](C)C[C@@H]5CC4[C@@H]3C5)cc2)c(C)c1CC(=O)O |
| InChI | InChI=1S/C26H33N3O3/c1-14-8-18-10-21-22(9-14)25(23(21)11-18)26(32)27-19-6-4-17(5-7-19)13-29-16(3)20(12-24(30)31)15(2)28-29/h4-7,14,18,21-23,25H,8-13H2,1-3H3,(H,27,32)(H,30,31)/t14-,18+,21?,22-,23-,25?/m0/s1 |
| InChIKey | PXTZPFJGWNIQLI-IDNDXEMISA-N |
| XLogP | 4.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |