C24H26N4O4 — CID 126490689
2-[(4R,5S,8S,10R)-3-(cyclopropylmethyl)-5,13-dihydroxy-2',4'-dioxospiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-1'-yl]acetonitrile (PubChem CID 126490689) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[(4R,5S,8S,10R)-3-(cyclopropylmethyl)-5,13-dihydroxy-2',4'-dioxospiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-1'-yl]acetonitrile.
| Compound Name | 2-[(4R,5S,8S,10R)-3-(cyclopropylmethyl)-5,13-dihydroxy-2',4'-dioxospiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-1'-yl]acetonitrile |
|---|---|
| PubChem CID | 126490689 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[(4R,5S,8S,10R)-3-(cyclopropylmethyl)-5,13-dihydroxy-2',4'-dioxospiro[3-azapentacyclo[8.6.1.01,4.05,10.011,16]heptadeca-11(16),12,14-triene-8,5'-imidazolidine]-1'-yl]acetonitrile |
| SMILES | N#CCN1C(=O)NC(=O)[C@@]12CC[C@@]1(O)[C@@H]3N(CC4CC4)CC34C[C@@]1(C2)c1cc(O)ccc14 |
| InChI | InChI=1S/C24H26N4O4/c25-7-8-28-20(31)26-19(30)23(28)5-6-24(32)18-21(13-27(18)10-14-1-2-14)11-22(24,12-23)17-9-15(29)3-4-16(17)21/h3-4,9,14,18,29,32H,1-2,5-6,8,10-13H2,(H,26,30,31)/t18-,21?,22-,23+,24-/m1/s1 |
| InChIKey | OMYHYDSHQHGKGH-CTSMQSTOSA-N |
| XLogP | 1.11 |
| TPSA | 116.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|