C11H19N7O2 — CID 126490815
2-[4-[3-(diaminomethylideneamino)propyl]triazol-1-yl]-N-(3-oxopropyl)acetamide (PubChem CID 126490815) has the molecular formula C11H19N7O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-[4-[3-(diaminomethylideneamino)propyl]triazol-1-yl]-N-(3-oxopropyl)acetamide.
| Compound Name | 2-[4-[3-(diaminomethylideneamino)propyl]triazol-1-yl]-N-(3-oxopropyl)acetamide |
|---|---|
| PubChem CID | 126490815 |
| Molecular Formula | C11H19N7O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[4-[3-(diaminomethylideneamino)propyl]triazol-1-yl]-N-(3-oxopropyl)acetamide |
| SMILES | NC(N)=NCCCc1cn(CC(=O)NCCC=O)nn1 |
| InChI | InChI=1S/C11H19N7O2/c12-11(13)15-4-1-3-9-7-18(17-16-9)8-10(20)14-5-2-6-19/h6-7H,1-5,8H2,(H,14,20)(H4,12,13,15) |
| InChIKey | HZMZFAIQQAUUGY-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|