C24H30N2O3 — CID 126494130
N-[4-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexa-1,3-dien-1-yl]acetamide (PubChem CID 126494130) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-[4-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexa-1,3-dien-1-yl]acetamide.
| Compound Name | N-[4-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexa-1,3-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 126494130 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | N-[4-[(1S,9R)-6-hydroxy-1,13,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-10-carbonyl]cyclohexa-1,3-dien-1-yl]acetamide |
| SMILES | CC(=O)NC1=CC=C(C(=O)N2CC[C@@]3(C)c4cccc(O)c4C[C@@H]2C3(C)C)CC1 |
| InChI | InChI=1S/C24H30N2O3/c1-15(27)25-17-10-8-16(9-11-17)22(29)26-13-12-24(4)19-6-5-7-20(28)18(19)14-21(26)23(24,2)3/h5-8,10,21,28H,9,11-14H2,1-4H3,(H,25,27)/t21-,24+/m1/s1 |
| InChIKey | KWLITBMMUGRYIL-QPPBQGQZSA-N |
| XLogP | 3.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |