C24H18N2O — CID 126495223
2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole (PubChem CID 126495223) has the molecular formula C24H18N2O and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole.
| Compound Name | 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 126495223 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole |
| SMILES | Cn1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c2ccccc21 |
| InChI | InChI=1S/C24H18N2O/c1-26-16-20(19-14-8-9-15-21(19)26)24-25-22(17-10-4-2-5-11-17)23(27-24)18-12-6-3-7-13-18/h2-16H,1H3 |
| InChIKey | JQFLEIGUJHDWDQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |