About 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole
2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole (PubChem CID 126495223) has the molecular formula C24H18N2O
and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole |
| PubChem CID | 126495223 |
| Molecular Formula | C24H18N2O |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole |
| SMILES | Cn1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c2ccccc21 |
| InChI | InChI=1S/C24H18N2O/c1-26-16-20(19-14-8-9-15-21(19)26)24-25-22(17-10-4-2-5-11-17)23(27-24)18-12-6-3-7-13-18/h2-16H,1H3 |
| InChIKey | JQFLEIGUJHDWDQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole?
The IUPAC name of 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole (CID 126495223) is 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole.
What is the SMILES notation for 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole?
The canonical SMILES for 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole is Cn1cc(-c2nc(-c3ccccc3)c(-c3ccccc3)o2)c2ccccc21.
What is the InChIKey of 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole?
The InChIKey is JQFLEIGUJHDWDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O/c1-26-16-20(19-14-8-9-15-21(19)26)24-25-22(17-10-4-2-5-11-17)23(27-24)18-12-6-3-7-13-18/h2-16H,1H3.
What are the key properties of 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole?
2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole has a molecular weight of 350.42 g/mol, XLogP of 6.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylindol-3-yl)-4,5-diphenyl-1,3-oxazole is sourced from PubChem (CID 126495223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).