C29H34N4 — CID 126497165
9-[2,6-di(propan-2-yl)phenyl]-5-ethenyl-6,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinoline (PubChem CID 126497165) has the molecular formula C29H34N4 and a molecular weight of 438.62 g/mol. Its IUPAC name is 9-[2,6-di(propan-2-yl)phenyl]-5-ethenyl-6,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinoline.
| Compound Name | 9-[2,6-di(propan-2-yl)phenyl]-5-ethenyl-6,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinoline |
|---|---|
| PubChem CID | 126497165 |
| Molecular Formula | C29H34N4 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | 9-[2,6-di(propan-2-yl)phenyl]-5-ethenyl-6,7-dimethyl-6,6a-dihydro-5H-purino[7,8-a]quinoline |
| SMILES | C=CC1c2ccccc2N2c3cnc(-c4c(C(C)C)cccc4C(C)C)nc3N(C)C2C1C |
| InChI | InChI=1S/C29H34N4/c1-8-20-19(6)29-32(7)28-25(33(29)24-15-10-9-12-23(20)24)16-30-27(31-28)26-21(17(2)3)13-11-14-22(26)18(4)5/h8-20,29H,1H2,2-7H3 |
| InChIKey | SFOXNHPJSPVGBF-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|