C26H28N4 — CID 155034376
15-tert-butyl-8-ethenyl-9-methyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene (PubChem CID 155034376) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is 15-tert-butyl-8-ethenyl-9-methyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene.
| Compound Name | 15-tert-butyl-8-ethenyl-9-methyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
|---|---|
| PubChem CID | 155034376 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 15-tert-butyl-8-ethenyl-9-methyl-11-phenyl-1,11,13,16-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaene |
| SMILES | C=CC1c2ccccc2N2c3nc(C(C)(C)C)cnc3N(c3ccccc3)C2C1C |
| InChI | InChI=1S/C26H28N4/c1-6-19-17(2)25-29(18-12-8-7-9-13-18)23-24(28-22(16-27-23)26(3,4)5)30(25)21-15-11-10-14-20(19)21/h6-17,19,25H,1H2,2-5H3 |
| InChIKey | KWPIRUPVEHHINA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|