C30H27N3O5 — CID 126499205
4-[[4-(2-carbamoylphenyl)phenyl]methyl]-N-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-7-carboxamide (PubChem CID 126499205) has the molecular formula C30H27N3O5 and a molecular weight of 509.56 g/mol. Its IUPAC name is 4-[[4-(2-carbamoylphenyl)phenyl]methyl]-N-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-7-carboxamide.
| Compound Name | 4-[[4-(2-carbamoylphenyl)phenyl]methyl]-N-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 126499205 |
| Molecular Formula | C30H27N3O5 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 4-[[4-(2-carbamoylphenyl)phenyl]methyl]-N-[(3,4-dihydroxyphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-7-carboxamide |
| SMILES | NC(=O)c1ccccc1-c1ccc(CN2CCOc3cc(C(=O)NCc4ccc(O)c(O)c4)ccc32)cc1 |
| InChI | InChI=1S/C30H27N3O5/c31-29(36)24-4-2-1-3-23(24)21-8-5-19(6-9-21)18-33-13-14-38-28-16-22(10-11-25(28)33)30(37)32-17-20-7-12-26(34)27(35)15-20/h1-12,15-16,34-35H,13-14,17-18H2,(H2,31,36)(H,32,37) |
| InChIKey | BNIZVDFZMSXXLR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|