C31H27N3O6 — CID 126499255
4-[2-[[7-[(4-nitrophenyl)methylcarbamoyl]-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]cyclohepta-2,4,6-trien-1-yl]benzoic acid (PubChem CID 126499255) has the molecular formula C31H27N3O6 and a molecular weight of 537.57 g/mol. Its IUPAC name is 4-[2-[[7-[(4-nitrophenyl)methylcarbamoyl]-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]cyclohepta-2,4,6-trien-1-yl]benzoic acid.
| Compound Name | 4-[2-[[7-[(4-nitrophenyl)methylcarbamoyl]-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]cyclohepta-2,4,6-trien-1-yl]benzoic acid |
|---|---|
| PubChem CID | 126499255 |
| Molecular Formula | C31H27N3O6 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 4-[2-[[7-[(4-nitrophenyl)methylcarbamoyl]-2,3-dihydro-1,4-benzoxazin-4-yl]methyl]cyclohepta-2,4,6-trien-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2C=CC=CC=C2CN2CCOc3cc(C(=O)NCc4ccc([N+](=O)[O-])cc4)ccc32)cc1 |
| InChI | InChI=1S/C31H27N3O6/c35-30(32-19-21-6-13-26(14-7-21)34(38)39)24-12-15-28-29(18-24)40-17-16-33(28)20-25-4-2-1-3-5-27(25)22-8-10-23(11-9-22)31(36)37/h1-15,18,27H,16-17,19-20H2,(H,32,35)(H,36,37) |
| InChIKey | DOTONRLCSKHNBM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|