C25H30F4O4 — CID 126501882
9-[3-(2-methoxyethoxy)propyl]-9-[1,1,2,2-tetrafluoro-3-(2-methoxyethoxy)propyl]fluorene (PubChem CID 126501882) has the molecular formula C25H30F4O4 and a molecular weight of 470.50 g/mol. Its IUPAC name is 9-[3-(2-methoxyethoxy)propyl]-9-[1,1,2,2-tetrafluoro-3-(2-methoxyethoxy)propyl]fluorene.
| Compound Name | 9-[3-(2-methoxyethoxy)propyl]-9-[1,1,2,2-tetrafluoro-3-(2-methoxyethoxy)propyl]fluorene |
|---|---|
| PubChem CID | 126501882 |
| Molecular Formula | C25H30F4O4 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 9-[3-(2-methoxyethoxy)propyl]-9-[1,1,2,2-tetrafluoro-3-(2-methoxyethoxy)propyl]fluorene |
| SMILES | COCCOCCCC1(C(F)(F)C(F)(F)COCCOC)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H30F4O4/c1-30-14-16-32-13-7-12-23(25(28,29)24(26,27)18-33-17-15-31-2)21-10-5-3-8-19(21)20-9-4-6-11-22(20)23/h3-6,8-11H,7,12-18H2,1-2H3 |
| InChIKey | JGRSRDQJKWMAIZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|