C18H26N2O6 — CID 126503651
N-(5-ethynyl-2-pyridinyl)-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]acetamide (PubChem CID 126503651) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is N-(5-ethynyl-2-pyridinyl)-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]acetamide.
| Compound Name | N-(5-ethynyl-2-pyridinyl)-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 126503651 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-(5-ethynyl-2-pyridinyl)-2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]acetamide |
| SMILES | C#Cc1ccc(NC(=O)COCCOCCOCCOCCOC)nc1 |
| InChI | InChI=1S/C18H26N2O6/c1-3-16-4-5-17(19-14-16)20-18(21)15-26-13-12-25-11-10-24-9-8-23-7-6-22-2/h1,4-5,14H,6-13,15H2,2H3,(H,19,20,21) |
| InChIKey | PUQAZSGLAXCTQU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|