C16H22N2O4 — CID 147160524
N-(6-ethynyl-3-pyridinyl)-4-[2-(2-methoxyethoxy)ethoxy]butanamide (PubChem CID 147160524) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is N-(6-ethynyl-3-pyridinyl)-4-[2-(2-methoxyethoxy)ethoxy]butanamide.
| Compound Name | N-(6-ethynyl-3-pyridinyl)-4-[2-(2-methoxyethoxy)ethoxy]butanamide |
|---|---|
| PubChem CID | 147160524 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-(6-ethynyl-3-pyridinyl)-4-[2-(2-methoxyethoxy)ethoxy]butanamide |
| SMILES | C#Cc1ccc(NC(=O)CCCOCCOCCOC)cn1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-14-6-7-15(13-17-14)18-16(19)5-4-8-21-11-12-22-10-9-20-2/h1,6-7,13H,4-5,8-12H2,2H3,(H,18,19) |
| InChIKey | BVTDJMVBBKGREV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|