C25H27N3O3S2 — CID 126508527
N-[4-[3-[(4-oct-1-ynylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 126508527) has the molecular formula C25H27N3O3S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is N-[4-[3-[(4-oct-1-ynylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[3-[(4-oct-1-ynylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 126508527 |
| Molecular Formula | C25H27N3O3S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-[4-[3-[(4-oct-1-ynylphenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCCC#Cc1ccc(S(=O)(=O)Nc2cccc(-c3csc(NC(C)=O)n3)c2)cc1 |
| InChI | InChI=1S/C25H27N3O3S2/c1-3-4-5-6-7-8-10-20-13-15-23(16-14-20)33(30,31)28-22-12-9-11-21(17-22)24-18-32-25(27-24)26-19(2)29/h9,11-18,28H,3-7H2,1-2H3,(H,26,27,29) |
| InChIKey | IDTTUXGWHQNFGI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|