C14H14ClN3O5S — CID 126508949
ethyl 2-[2-(4-chloro-3-sulfamoylphenyl)-2-oxoethyl]-1H-imidazole-5-carboxylate (PubChem CID 126508949) has the molecular formula C14H14ClN3O5S and a molecular weight of 371.80 g/mol. Its IUPAC name is ethyl 2-[2-(4-chloro-3-sulfamoylphenyl)-2-oxoethyl]-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 2-[2-(4-chloro-3-sulfamoylphenyl)-2-oxoethyl]-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 126508949 |
| Molecular Formula | C14H14ClN3O5S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | ethyl 2-[2-(4-chloro-3-sulfamoylphenyl)-2-oxoethyl]-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC(=O)c2ccc(Cl)c(S(N)(=O)=O)c2)[nH]1 |
| InChI | InChI=1S/C14H14ClN3O5S/c1-2-23-14(20)10-7-17-13(18-10)6-11(19)8-3-4-9(15)12(5-8)24(16,21)22/h3-5,7H,2,6H2,1H3,(H,17,18)(H2,16,21,22) |
| InChIKey | UPUVQMOWPMOJCU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |