C6H9N3O4S — CID 58344441
ethyl 2-sulfamoyl-1H-imidazole-5-carboxylate (PubChem CID 58344441) has the molecular formula C6H9N3O4S and a molecular weight of 219.22 g/mol. Its IUPAC name is ethyl 2-sulfamoyl-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 2-sulfamoyl-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 58344441 |
| Molecular Formula | C6H9N3O4S |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | ethyl 2-sulfamoyl-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(S(N)(=O)=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O4S/c1-2-13-5(10)4-3-8-6(9-4)14(7,11)12/h3H,2H2,1H3,(H,8,9)(H2,7,11,12) |
| InChIKey | GBYVZGSYSSUMRN-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |