C13H15N3O2 — CID 156748397
ethyl 2-(3,5-dimethyl-2-pyridinyl)-1H-imidazole-5-carboxylate (PubChem CID 156748397) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethyl-2-pyridinyl)-1H-imidazole-5-carboxylate.
| Compound Name | ethyl 2-(3,5-dimethyl-2-pyridinyl)-1H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 156748397 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 2-(3,5-dimethyl-2-pyridinyl)-1H-imidazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ncc(C)cc2C)[nH]1 |
| InChI | InChI=1S/C13H15N3O2/c1-4-18-13(17)10-7-15-12(16-10)11-9(3)5-8(2)6-14-11/h5-7H,4H2,1-3H3,(H,15,16) |
| InChIKey | XYOAREDOPZLIOS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |