C14H26O2 — CID 126510361
2-[(5-cyclobutyl-2-ethylpentoxy)methyl]oxirane (PubChem CID 126510361) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-[(5-cyclobutyl-2-ethylpentoxy)methyl]oxirane.
| Compound Name | 2-[(5-cyclobutyl-2-ethylpentoxy)methyl]oxirane |
|---|---|
| PubChem CID | 126510361 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-[(5-cyclobutyl-2-ethylpentoxy)methyl]oxirane |
| SMILES | CCC(CCCC1CCC1)COCC1CO1 |
| InChI | InChI=1S/C14H26O2/c1-2-12(9-15-10-14-11-16-14)5-3-6-13-7-4-8-13/h12-14H,2-11H2,1H3 |
| InChIKey | KRJVLXKUHUZZIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|