C27H44N2O2 — CID 160951593
aniline;N,N-dimethylaniline;2-(2-ethyloctoxymethyl)oxirane (PubChem CID 160951593) has the molecular formula C27H44N2O2 and a molecular weight of 428.66 g/mol. Its IUPAC name is aniline;N,N-dimethylaniline;2-(2-ethyloctoxymethyl)oxirane.
| Compound Name | aniline;N,N-dimethylaniline;2-(2-ethyloctoxymethyl)oxirane |
|---|---|
| PubChem CID | 160951593 |
| Molecular Formula | C27H44N2O2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | aniline;N,N-dimethylaniline;2-(2-ethyloctoxymethyl)oxirane |
| SMILES | CCCCCCC(CC)COCC1CO1.CN(C)c1ccccc1.Nc1ccccc1 |
| InChI | InChI=1S/C13H26O2.C8H11N.C6H7N/c1-3-5-6-7-8-12(4-2)9-14-10-13-11-15-13;1-9(2)8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h12-13H,3-11H2,1-2H3;3-7H,1-2H3;1-5H,7H2 |
| InChIKey | SVVHXMQMVJCHGM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 51.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|