C15H24N2O2 — CID 126515280
[3-amino-4-[[(1R,2R)-2-methylcyclohexyl]amino]phenyl]-methoxymethanol (PubChem CID 126515280) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is [3-amino-4-[[(1R,2R)-2-methylcyclohexyl]amino]phenyl]-methoxymethanol.
| Compound Name | [3-amino-4-[[(1R,2R)-2-methylcyclohexyl]amino]phenyl]-methoxymethanol |
|---|---|
| PubChem CID | 126515280 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | [3-amino-4-[[(1R,2R)-2-methylcyclohexyl]amino]phenyl]-methoxymethanol |
| SMILES | COC(O)c1ccc(N[C@@H]2CCCC[C@H]2C)c(N)c1 |
| InChI | InChI=1S/C15H24N2O2/c1-10-5-3-4-6-13(10)17-14-8-7-11(9-12(14)16)15(18)19-2/h7-10,13,15,17-18H,3-6,16H2,1-2H3/t10-,13-,15?/m1/s1 |
| InChIKey | KRPZOSOFWUYVFL-BAOLWLNASA-N |
| XLogP | 2.90 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|