C22H14N4O5 — CID 12652338
(7E)-4-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2-oxo-5,6-dihydro-1H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 12652338) has the molecular formula C22H14N4O5 and a molecular weight of 414.38 g/mol. Its IUPAC name is (7E)-4-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2-oxo-5,6-dihydro-1H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | (7E)-4-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2-oxo-5,6-dihydro-1H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12652338 |
| Molecular Formula | C22H14N4O5 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (7E)-4-(3-nitrophenyl)-7-[(3-nitrophenyl)methylidene]-2-oxo-5,6-dihydro-1H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc([N+](=O)[O-])c2)c2c([nH]c1=O)/C(=C/c1cccc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C22H14N4O5/c23-12-19-20(14-4-2-6-17(11-14)26(30)31)18-8-7-15(21(18)24-22(19)27)9-13-3-1-5-16(10-13)25(28)29/h1-6,9-11H,7-8H2,(H,24,27)/b15-9+ |
| InChIKey | YQFIIMXYDUDPQP-OQLLNIDSSA-N |
| XLogP | 4.22 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|