C29H20N6O6 — CID 177408850
(8Z)-2-(3-nitroanilino)-4-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-6,7-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 177408850) has the molecular formula C29H20N6O6 and a molecular weight of 548.52 g/mol. Its IUPAC name is (8Z)-2-(3-nitroanilino)-4-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-6,7-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | (8Z)-2-(3-nitroanilino)-4-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-6,7-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 177408850 |
| Molecular Formula | C29H20N6O6 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | (8Z)-2-(3-nitroanilino)-4-(3-nitrophenyl)-8-[(3-nitrophenyl)methylidene]-6,7-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | N#Cc1c(Nc2cccc([N+](=O)[O-])c2)nc2c(c1-c1cccc([N+](=O)[O-])c1)CCC/C2=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H20N6O6/c30-17-26-27(19-6-2-10-23(15-19)34(38)39)25-12-3-7-20(13-18-5-1-9-22(14-18)33(36)37)28(25)32-29(26)31-21-8-4-11-24(16-21)35(40)41/h1-2,4-6,8-11,13-16H,3,7,12H2,(H,31,32)/b20-13- |
| InChIKey | KIRYTLJAEAMBNC-MOSHPQCFSA-N |
| XLogP | 6.97 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|