C29H23N7O2 — CID 10864034
(5E)-5-benzylidene-3-[(4-nitrophenyl)diazenyl]-9-phenyl-7,8-dihydro-6H-pyrazolo[5,1-b]quinazolin-2-amine (PubChem CID 10864034) has the molecular formula C29H23N7O2 and a molecular weight of 501.55 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-[(4-nitrophenyl)diazenyl]-9-phenyl-7,8-dihydro-6H-pyrazolo[5,1-b]quinazolin-2-amine.
| Compound Name | (5E)-5-benzylidene-3-[(4-nitrophenyl)diazenyl]-9-phenyl-7,8-dihydro-6H-pyrazolo[5,1-b]quinazolin-2-amine |
|---|---|
| PubChem CID | 10864034 |
| Molecular Formula | C29H23N7O2 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (5E)-5-benzylidene-3-[(4-nitrophenyl)diazenyl]-9-phenyl-7,8-dihydro-6H-pyrazolo[5,1-b]quinazolin-2-amine |
| SMILES | Nc1nn2c(-c3ccccc3)c3c(nc2c1/N=N/c1ccc([N+](=O)[O-])cc1)/C(=C/c1ccccc1)CCC3 |
| InChI | InChI=1S/C29H23N7O2/c30-28-26(33-32-22-14-16-23(17-15-22)36(37)38)29-31-25-21(18-19-8-3-1-4-9-19)12-7-13-24(25)27(35(29)34-28)20-10-5-2-6-11-20/h1-6,8-11,14-18H,7,12-13H2,(H2,30,34)/b21-18+,33-32+ |
| InChIKey | NSZBJXLMBTXQPL-HRORQGHQSA-N |
| XLogP | 7.18 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|