C24H27F3N6OS — CID 126534010
4-[5-[3-[(3aS,6aS)-6-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one (PubChem CID 126534010) has the molecular formula C24H27F3N6OS and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[5-[3-[(3aS,6aS)-6-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one.
| Compound Name | 4-[5-[3-[(3aS,6aS)-6-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 126534010 |
| Molecular Formula | C24H27F3N6OS |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 4-[5-[3-[(3aS,6aS)-6-[4-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1H-pyridin-2-one |
| SMILES | Cn1c(SCCCN2C[C@@H]3CCN[C@@H]3C2c2ccc(C(F)(F)F)cc2)nnc1-c1cc[nH]c(=O)c1 |
| InChI | InChI=1S/C24H27F3N6OS/c1-32-22(16-7-9-28-19(34)13-16)30-31-23(32)35-12-2-11-33-14-17-8-10-29-20(17)21(33)15-3-5-18(6-4-15)24(25,26)27/h3-7,9,13,17,20-21,29H,2,8,10-12,14H2,1H3,(H,28,34)/t17-,20-,21?/m0/s1 |
| InChIKey | JKTACBQTQIQKHM-LTGDSAQFSA-N |
| XLogP | 3.71 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|