C23H31F3N6OS — CID 126537303
[2-[1-(1H-indol-3-yl)hexan-2-ylamino]-2-oxoethanimidoyl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboximidothioate (PubChem CID 126537303) has the molecular formula C23H31F3N6OS and a molecular weight of 496.60 g/mol. Its IUPAC name is [2-[1-(1H-indol-3-yl)hexan-2-ylamino]-2-oxoethanimidoyl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboximidothioate.
| Compound Name | [2-[1-(1H-indol-3-yl)hexan-2-ylamino]-2-oxoethanimidoyl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboximidothioate |
|---|---|
| PubChem CID | 126537303 |
| Molecular Formula | C23H31F3N6OS |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [2-[1-(1H-indol-3-yl)hexan-2-ylamino]-2-oxoethanimidoyl] 4-(2,2,2-trifluoroethyl)piperazine-1-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])N1CCN(CC(F)(F)F)CC1)C(=O)NC(CCCC)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H31F3N6OS/c1-2-3-6-17(13-16-14-29-19-8-5-4-7-18(16)19)30-21(33)20(27)34-22(28)32-11-9-31(10-12-32)15-23(24,25)26/h4-5,7-8,14,17,27-29H,2-3,6,9-13,15H2,1H3,(H,30,33)/b27-20-,28-22+ |
| InChIKey | YRKXDYKCSAEVAB-KNEZJZKDSA-N |
| XLogP | 4.21 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|