C25H39N7O2 — CID 145241261
(2Z)-2-amino-N-[1-(1H-indol-3-yl)-5-methylhexan-2-yl]-2-[4-(2-methoxyethyl)piperazine-1-carboximidoyl]iminoacetamide (PubChem CID 145241261) has the molecular formula C25H39N7O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is (2Z)-2-amino-N-[1-(1H-indol-3-yl)-5-methylhexan-2-yl]-2-[4-(2-methoxyethyl)piperazine-1-carboximidoyl]iminoacetamide.
| Compound Name | (2Z)-2-amino-N-[1-(1H-indol-3-yl)-5-methylhexan-2-yl]-2-[4-(2-methoxyethyl)piperazine-1-carboximidoyl]iminoacetamide |
|---|---|
| PubChem CID | 145241261 |
| Molecular Formula | C25H39N7O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.32 |
| IUPAC Name | (2Z)-2-amino-N-[1-(1H-indol-3-yl)-5-methylhexan-2-yl]-2-[4-(2-methoxyethyl)piperazine-1-carboximidoyl]iminoacetamide |
| SMILES | [H]/N=C(/N=C(\N)C(=O)NC(CCC(C)C)Cc1c[nH]c2ccccc12)N1CCN(CCOC)CC1 |
| InChI | InChI=1S/C25H39N7O2/c1-18(2)8-9-20(16-19-17-28-22-7-5-4-6-21(19)22)29-24(33)23(26)30-25(27)32-12-10-31(11-13-32)14-15-34-3/h4-7,17-18,20,28H,8-16H2,1-3H3,(H,29,33)(H3,26,27,30) |
| InChIKey | IFRWJJJGMRTJDV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|