C23H33F2N7O — CID 145241312
(2Z)-2-amino-2-[3-(difluoromethyl)-4-methylpiperazine-1-carboximidoyl]imino-N-[1-(1H-indol-3-yl)hexan-2-yl]acetamide (PubChem CID 145241312) has the molecular formula C23H33F2N7O and a molecular weight of 461.56 g/mol. Its IUPAC name is (2Z)-2-amino-2-[3-(difluoromethyl)-4-methylpiperazine-1-carboximidoyl]imino-N-[1-(1H-indol-3-yl)hexan-2-yl]acetamide.
| Compound Name | (2Z)-2-amino-2-[3-(difluoromethyl)-4-methylpiperazine-1-carboximidoyl]imino-N-[1-(1H-indol-3-yl)hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 145241312 |
| Molecular Formula | C23H33F2N7O |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | (2Z)-2-amino-2-[3-(difluoromethyl)-4-methylpiperazine-1-carboximidoyl]imino-N-[1-(1H-indol-3-yl)hexan-2-yl]acetamide |
| SMILES | [H]/N=C(/N=C(\N)C(=O)NC(CCCC)Cc1c[nH]c2ccccc12)N1CCN(C)C(C(F)F)C1 |
| InChI | InChI=1S/C23H33F2N7O/c1-3-4-7-16(12-15-13-28-18-9-6-5-8-17(15)18)29-22(33)21(26)30-23(27)32-11-10-31(2)19(14-32)20(24)25/h5-6,8-9,13,16,19-20,28H,3-4,7,10-12,14H2,1-2H3,(H,29,33)(H3,26,27,30) |
| InChIKey | BAWRWTMVTPPSEK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|