C23H32F3N7O — CID 162623201
2-amino-N-[1-(1H-indol-3-yl)hexan-2-yl]-2-[4-methyl-3-(trifluoromethyl)piperazine-1-carboximidoyl]iminoacetamide (PubChem CID 162623201) has the molecular formula C23H32F3N7O and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-amino-N-[1-(1H-indol-3-yl)hexan-2-yl]-2-[4-methyl-3-(trifluoromethyl)piperazine-1-carboximidoyl]iminoacetamide.
| Compound Name | 2-amino-N-[1-(1H-indol-3-yl)hexan-2-yl]-2-[4-methyl-3-(trifluoromethyl)piperazine-1-carboximidoyl]iminoacetamide |
|---|---|
| PubChem CID | 162623201 |
| Molecular Formula | C23H32F3N7O |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-amino-N-[1-(1H-indol-3-yl)hexan-2-yl]-2-[4-methyl-3-(trifluoromethyl)piperazine-1-carboximidoyl]iminoacetamide |
| SMILES | [H]/N=C(/N=C(N)C(=O)NC(CCCC)Cc1c[nH]c2ccccc12)N1CCN(C)C(C(F)(F)F)C1 |
| InChI | InChI=1S/C23H32F3N7O/c1-3-4-7-16(12-15-13-29-18-9-6-5-8-17(15)18)30-21(34)20(27)31-22(28)33-11-10-32(2)19(14-33)23(24,25)26/h5-6,8-9,13,16,19,29H,3-4,7,10-12,14H2,1-2H3,(H,30,34)(H3,27,28,31) |
| InChIKey | HXFXYLGPWVBCRH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|