C37H37N3 — CID 126538222
14-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-5,6-dicarbonitrile (PubChem CID 126538222) has the molecular formula C37H37N3 and a molecular weight of 523.72 g/mol. Its IUPAC name is 14-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-5,6-dicarbonitrile.
| Compound Name | 14-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 126538222 |
| Molecular Formula | C37H37N3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | 14-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)tricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-5,6-dicarbonitrile |
| SMILES | CC(C)(C)c1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)Cc2cc(C#N)c(C#N)cc2CC3)cc1 |
| InChI | InChI=1S/C37H37N3/c1-36(2,3)31-10-15-33(16-11-31)40(34-17-12-32(13-18-34)37(4,5)6)35-14-9-25-7-8-26-19-29(23-38)30(24-39)21-27(26)20-28(25)22-35/h9-19,21-22H,7-8,20H2,1-6H3 |
| InChIKey | XUBUXRIFRKRYSQ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |