C7H13FN2 — CID 126539600
2-[(2E)-4-fluoropenta-2,4-dien-2-yl]-1,1-dimethylhydrazine (PubChem CID 126539600) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is 2-[(2E)-4-fluoropenta-2,4-dien-2-yl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(2E)-4-fluoropenta-2,4-dien-2-yl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 126539600 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 2-[(2E)-4-fluoropenta-2,4-dien-2-yl]-1,1-dimethylhydrazine |
| SMILES | C=C(F)/C=C(\C)NN(C)C |
| InChI | InChI=1S/C7H13FN2/c1-6(8)5-7(2)9-10(3)4/h5,9H,1H2,2-4H3/b7-5+ |
| InChIKey | QSDPNAUQEYZQPU-FNORWQNLSA-N |
| XLogP | 1.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|