C49H39NO2 — CID 126542787
4,7-bis[2,3-bis(4-methylphenyl)phenyl]-2-methylisoindole-1,3-dione (PubChem CID 126542787) has the molecular formula C49H39NO2 and a molecular weight of 673.86 g/mol. Its IUPAC name is 4,7-bis[2,3-bis(4-methylphenyl)phenyl]-2-methylisoindole-1,3-dione.
| Compound Name | 4,7-bis[2,3-bis(4-methylphenyl)phenyl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 126542787 |
| Molecular Formula | C49H39NO2 |
| Molecular Weight | 673.86 g/mol |
| Exact Mass | 673.30 |
| IUPAC Name | 4,7-bis[2,3-bis(4-methylphenyl)phenyl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(-c4cccc(-c5ccc(C)cc5)c4-c4ccc(C)cc4)c4c3C(=O)N(C)C4=O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C49H39NO2/c1-30-12-20-34(21-13-30)38-8-6-10-40(44(38)36-24-16-32(3)17-25-36)42-28-29-43(47-46(42)48(51)50(5)49(47)52)41-11-7-9-39(35-22-14-31(2)15-23-35)45(41)37-26-18-33(4)19-27-37/h6-29H,1-5H3 |
| InChIKey | YICMGIRJJSYFIM-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.86 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|