C28H20OS — CID 154309028
1,8-bis(4-methylphenyl)-10-sulfanylideneanthracen-9-one (PubChem CID 154309028) has the molecular formula C28H20OS and a molecular weight of 404.53 g/mol. Its IUPAC name is 1,8-bis(4-methylphenyl)-10-sulfanylideneanthracen-9-one.
| Compound Name | 1,8-bis(4-methylphenyl)-10-sulfanylideneanthracen-9-one |
|---|---|
| PubChem CID | 154309028 |
| Molecular Formula | C28H20OS |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 1,8-bis(4-methylphenyl)-10-sulfanylideneanthracen-9-one |
| SMILES | Cc1ccc(-c2cccc3c2C(=O)c2c(cccc2-c2ccc(C)cc2)C3=S)cc1 |
| InChI | InChI=1S/C28H20OS/c1-17-9-13-19(14-10-17)21-5-3-7-23-25(21)27(29)26-22(6-4-8-24(26)28(23)30)20-15-11-18(2)12-16-20/h3-16H,1-2H3 |
| InChIKey | OLZZRVAIRUKZHY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|