C46H38N2 — CID 126542800
3,6-bis[2,3-bis(4-methylphenyl)phenyl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 126542800) has the molecular formula C46H38N2 and a molecular weight of 618.82 g/mol. Its IUPAC name is 3,6-bis[2,3-bis(4-methylphenyl)phenyl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3,6-bis[2,3-bis(4-methylphenyl)phenyl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 126542800 |
| Molecular Formula | C46H38N2 |
| Molecular Weight | 618.82 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | 3,6-bis[2,3-bis(4-methylphenyl)phenyl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1/C(c2cccc(-c3ccc(C)cc3)c2-c2ccc(C)cc2)=CC=C(c2cccc(-c3ccc(C)cc3)c2-c2ccc(C)cc2)/C1=N\[H] |
| InChI | InChI=1S/C46H38N2/c1-29-11-19-33(20-12-29)37-7-5-9-39(43(37)35-23-15-31(3)16-24-35)41-27-28-42(46(48)45(41)47)40-10-6-8-38(34-21-13-30(2)14-22-34)44(40)36-25-17-32(4)18-26-36/h5-28,47-48H,1-4H3/b47-45-,48-46+ |
| InChIKey | NMEYTFNHIBZZAV-OCQXYXTHSA-N |
| XLogP | 12.11 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.82 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|