C28H29FO6 — CID 126545411
prop-2-enyl (3aR,5R)-3a-[(2S)-1-(2-fluoro-4-methyl-5-phenylmethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate (PubChem CID 126545411) has the molecular formula C28H29FO6 and a molecular weight of 480.53 g/mol. Its IUPAC name is prop-2-enyl (3aR,5R)-3a-[(2S)-1-(2-fluoro-4-methyl-5-phenylmethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | prop-2-enyl (3aR,5R)-3a-[(2S)-1-(2-fluoro-4-methyl-5-phenylmethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126545411 |
| Molecular Formula | C28H29FO6 |
| Molecular Weight | 480.53 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | prop-2-enyl (3aR,5R)-3a-[(2S)-1-(2-fluoro-4-methyl-5-phenylmethoxyphenyl)propan-2-yl]-6-oxo-4,5-dihydro-1,3-benzodioxole-5-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1C[C@]2([C@@H](C)Cc3cc(OCc4ccccc4)c(C)cc3F)OCOC2=CC1=O |
| InChI | InChI=1S/C28H29FO6/c1-4-10-32-27(31)22-15-28(26(14-24(22)30)34-17-35-28)19(3)12-21-13-25(18(2)11-23(21)29)33-16-20-8-6-5-7-9-20/h4-9,11,13-14,19,22H,1,10,12,15-17H2,2-3H3/t19-,22+,28+/m0/s1 |
| InChIKey | YIVYKBJFFYVXCJ-NSLQWWKHSA-N |
| XLogP | 4.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|