C32H37FO7 — CID 126547023
prop-2-enyl (3aR)-5-benzyl-3a-[(2R)-1-(5-butoxy-2-fluoro-4-methoxyphenyl)propan-2-yl]-6-oxo-4H-1,3-benzodioxole-5-carboxylate (PubChem CID 126547023) has the molecular formula C32H37FO7 and a molecular weight of 552.64 g/mol. Its IUPAC name is prop-2-enyl (3aR)-5-benzyl-3a-[(2R)-1-(5-butoxy-2-fluoro-4-methoxyphenyl)propan-2-yl]-6-oxo-4H-1,3-benzodioxole-5-carboxylate.
| Compound Name | prop-2-enyl (3aR)-5-benzyl-3a-[(2R)-1-(5-butoxy-2-fluoro-4-methoxyphenyl)propan-2-yl]-6-oxo-4H-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 126547023 |
| Molecular Formula | C32H37FO7 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | prop-2-enyl (3aR)-5-benzyl-3a-[(2R)-1-(5-butoxy-2-fluoro-4-methoxyphenyl)propan-2-yl]-6-oxo-4H-1,3-benzodioxole-5-carboxylate |
| SMILES | C=CCOC(=O)C1(Cc2ccccc2)C[C@]2([C@H](C)Cc3cc(OCCCC)c(OC)cc3F)OCOC2=CC1=O |
| InChI | InChI=1S/C32H37FO7/c1-5-7-14-37-27-16-24(25(33)17-26(27)36-4)15-22(3)32-20-31(30(35)38-13-6-2,19-23-11-9-8-10-12-23)28(34)18-29(32)39-21-40-32/h6,8-12,16-18,22H,2,5,7,13-15,19-21H2,1,3-4H3/t22-,31?,32-/m1/s1 |
| InChIKey | FLPZCXYCTPMSAA-AJAWQQCNSA-N |
| XLogP | 5.75 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|