C17H18N4O2 — CID 126551536
(1S,3S,4S,7S)-3,7,8-trimethyl-6,9-dioxo-4-pyridin-3-yl-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 126551536) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is (1S,3S,4S,7S)-3,7,8-trimethyl-6,9-dioxo-4-pyridin-3-yl-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (1S,3S,4S,7S)-3,7,8-trimethyl-6,9-dioxo-4-pyridin-3-yl-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 126551536 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (1S,3S,4S,7S)-3,7,8-trimethyl-6,9-dioxo-4-pyridin-3-yl-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | CN1C(=O)[C@@]23C[C@](C)(C#N)[C@H](c4cccnc4)N2C(=O)[C@]1(C)C3 |
| InChI | InChI=1S/C17H18N4O2/c1-15(10-18)8-17-9-16(2,20(3)14(17)23)13(22)21(17)12(15)11-5-4-6-19-7-11/h4-7,12H,8-9H2,1-3H3/t12-,15+,16-,17-/m0/s1 |
| InChIKey | PAGMUZGFHIAXGK-IEAZIUSSSA-N |
| XLogP | 1.26 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |