C19H30O2 — CID 126552269
(3aS,5aR,6aR,8S,10aS,11aR,11bS)-3a-methylspiro[2,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracene-3,2'-oxirane]-8-ol (PubChem CID 126552269) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3aS,5aR,6aR,8S,10aS,11aR,11bS)-3a-methylspiro[2,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracene-3,2'-oxirane]-8-ol.
| Compound Name | (3aS,5aR,6aR,8S,10aS,11aR,11bS)-3a-methylspiro[2,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracene-3,2'-oxirane]-8-ol |
|---|---|
| PubChem CID | 126552269 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (3aS,5aR,6aR,8S,10aS,11aR,11bS)-3a-methylspiro[2,4,5,5a,6,6a,7,8,9,10,10a,11,11a,11b-tetradecahydro-1H-cyclopenta[a]anthracene-3,2'-oxirane]-8-ol |
| SMILES | C[C@]12CC[C@@H]3C[C@@H]4C[C@@H](O)CC[C@H]4C[C@H]3[C@@H]1CCC21CO1 |
| InChI | InChI=1S/C19H30O2/c1-18-6-4-13-8-14-9-15(20)3-2-12(14)10-16(13)17(18)5-7-19(18)11-21-19/h12-17,20H,2-11H2,1H3/t12-,13+,14+,15-,16+,17-,18-,19?/m0/s1 |
| InChIKey | XWIHVDBOAKPSAI-HUTACKQTSA-N |
| XLogP | 3.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|