C19H30O2 — CID 24807806
(1S,3aS,4aR,5aS,7R,9aR,10aR,11aS)-11a-methylspiro[3,3a,4,4a,5,5a,6,7,8,9,9a,10,10a,11-tetradecahydro-2H-cyclopenta[b]anthracene-1,2'-oxirane]-7-ol (PubChem CID 24807806) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1S,3aS,4aR,5aS,7R,9aR,10aR,11aS)-11a-methylspiro[3,3a,4,4a,5,5a,6,7,8,9,9a,10,10a,11-tetradecahydro-2H-cyclopenta[b]anthracene-1,2'-oxirane]-7-ol.
| Compound Name | (1S,3aS,4aR,5aS,7R,9aR,10aR,11aS)-11a-methylspiro[3,3a,4,4a,5,5a,6,7,8,9,9a,10,10a,11-tetradecahydro-2H-cyclopenta[b]anthracene-1,2'-oxirane]-7-ol |
|---|---|
| PubChem CID | 24807806 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1S,3aS,4aR,5aS,7R,9aR,10aR,11aS)-11a-methylspiro[3,3a,4,4a,5,5a,6,7,8,9,9a,10,10a,11-tetradecahydro-2H-cyclopenta[b]anthracene-1,2'-oxirane]-7-ol |
| SMILES | C[C@]12C[C@H]3C[C@H]4CC[C@@H](O)C[C@@H]4C[C@@H]3C[C@@H]1CC[C@@]21CO1 |
| InChI | InChI=1S/C19H30O2/c1-18-10-15-6-12-2-3-17(20)9-14(12)7-13(15)8-16(18)4-5-19(18)11-21-19/h12-17,20H,2-11H2,1H3/t12-,13-,14+,15-,16+,17-,18+,19-/m1/s1 |
| InChIKey | PLESDGJNPFSHNZ-DERWZFJFSA-N |
| XLogP | 3.77 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|