C13H8F8O3 — CID 12656487
4,4,5,5,5-pentafluoro-1-(4-methoxyphenyl)-2-(trifluoromethyl)pentane-1,3-dione (PubChem CID 12656487) has the molecular formula C13H8F8O3 and a molecular weight of 364.19 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-1-(4-methoxyphenyl)-2-(trifluoromethyl)pentane-1,3-dione.
| Compound Name | 4,4,5,5,5-pentafluoro-1-(4-methoxyphenyl)-2-(trifluoromethyl)pentane-1,3-dione |
|---|---|
| PubChem CID | 12656487 |
| Molecular Formula | C13H8F8O3 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-1-(4-methoxyphenyl)-2-(trifluoromethyl)pentane-1,3-dione |
| SMILES | COc1ccc(C(=O)C(C(=O)C(F)(F)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H8F8O3/c1-24-7-4-2-6(3-5-7)9(22)8(12(16,17)18)10(23)11(14,15)13(19,20)21/h2-5,8H,1H3 |
| InChIKey | PIRRBZGTHAKRMZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|