C13H16FIN2O3 — CID 126565393
2-iodopropan-2-yl N-[1-(3-fluoro-6-formyl-2-pyridinyl)propyl]carbamate (PubChem CID 126565393) has the molecular formula C13H16FIN2O3 and a molecular weight of 394.18 g/mol. Its IUPAC name is 2-iodopropan-2-yl N-[1-(3-fluoro-6-formyl-2-pyridinyl)propyl]carbamate.
| Compound Name | 2-iodopropan-2-yl N-[1-(3-fluoro-6-formyl-2-pyridinyl)propyl]carbamate |
|---|---|
| PubChem CID | 126565393 |
| Molecular Formula | C13H16FIN2O3 |
| Molecular Weight | 394.18 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 2-iodopropan-2-yl N-[1-(3-fluoro-6-formyl-2-pyridinyl)propyl]carbamate |
| SMILES | CCC(NC(=O)OC(C)(C)I)c1nc(C=O)ccc1F |
| InChI | InChI=1S/C13H16FIN2O3/c1-4-10(17-12(19)20-13(2,3)15)11-9(14)6-5-8(7-18)16-11/h5-7,10H,4H2,1-3H3,(H,17,19) |
| InChIKey | ITCGTBLDIWFUCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|